C36H38N4O3S — CID 66913613
N-[1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxo-3-phenylpropan-2-yl]-3-(2-methyl-1,3-thiazol-4-yl)-N-[(4-morpholin-4-ylphenyl)methyl]prop-2-enamide (PubChem CID 66913613) has the molecular formula C36H38N4O3S and a molecular weight of 606.79 g/mol. Its IUPAC name is N-[1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxo-3-phenylpropan-2-yl]-3-(2-methyl-1,3-thiazol-4-yl)-N-[(4-morpholin-4-ylphenyl)methyl]prop-2-enamide.
| Compound Name | N-[1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxo-3-phenylpropan-2-yl]-3-(2-methyl-1,3-thiazol-4-yl)-N-[(4-morpholin-4-ylphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 66913613 |
| Molecular Formula | C36H38N4O3S |
| Molecular Weight | 606.79 g/mol |
| Exact Mass | 606.27 |
| IUPAC Name | N-[1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxo-3-phenylpropan-2-yl]-3-(2-methyl-1,3-thiazol-4-yl)-N-[(4-morpholin-4-ylphenyl)methyl]prop-2-enamide |
| SMILES | Cc1nc(C=CC(=O)N(Cc2ccc(N3CCOCC3)cc2)C(Cc2ccccc2)C(=O)N2CCc3ccccc3C2)cs1 |
| InChI | InChI=1S/C36H38N4O3S/c1-27-37-32(26-44-27)13-16-35(41)40(24-29-11-14-33(15-12-29)38-19-21-43-22-20-38)34(23-28-7-3-2-4-8-28)36(42)39-18-17-30-9-5-6-10-31(30)25-39/h2-16,26,34H,17-25H2,1H3 |
| InChIKey | JYPMEJJVICLXBY-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.79 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|