C39H32F3N3O2 — CID 66913811
N-[(2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxo-3-phenylpropan-2-yl]-N-[(4-pyridin-2-ylphenyl)methyl]-3-(2,3,6-trifluorophenyl)prop-2-enamide (PubChem CID 66913811) has the molecular formula C39H32F3N3O2 and a molecular weight of 631.70 g/mol. Its IUPAC name is N-[(2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxo-3-phenylpropan-2-yl]-N-[(4-pyridin-2-ylphenyl)methyl]-3-(2,3,6-trifluorophenyl)prop-2-enamide.
| Compound Name | N-[(2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxo-3-phenylpropan-2-yl]-N-[(4-pyridin-2-ylphenyl)methyl]-3-(2,3,6-trifluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 66913811 |
| Molecular Formula | C39H32F3N3O2 |
| Molecular Weight | 631.70 g/mol |
| Exact Mass | 631.24 |
| IUPAC Name | N-[(2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxo-3-phenylpropan-2-yl]-N-[(4-pyridin-2-ylphenyl)methyl]-3-(2,3,6-trifluorophenyl)prop-2-enamide |
| SMILES | O=C([C@H](Cc1ccccc1)N(Cc1ccc(-c2ccccn2)cc1)C(=O)C=Cc1c(F)ccc(F)c1F)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C39H32F3N3O2/c40-33-18-19-34(41)38(42)32(33)17-20-37(46)45(25-28-13-15-30(16-14-28)35-12-6-7-22-43-35)36(24-27-8-2-1-3-9-27)39(47)44-23-21-29-10-4-5-11-31(29)26-44/h1-20,22,36H,21,23-26H2/t36-/m0/s1 |
| InChIKey | URZVYPHAQDZVSJ-BHVANESWSA-N |
| XLogP | 7.40 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.70 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|