About 4-[3-[(2,5-dimethylphenyl)methoxy]phenyl]-3-phenyl-8-(trifluoromethyl)quinoline
4-[3-[(2,5-dimethylphenyl)methoxy]phenyl]-3-phenyl-8-(trifluoromethyl)quinoline (PubChem CID 66914032) has the molecular formula C31H24F3NO
and a molecular weight of 483.53 g/mol. Its IUPAC name is 4-[3-[(2,5-dimethylphenyl)methoxy]phenyl]-3-phenyl-8-(trifluoromethyl)quinoline.
Molecular Properties
| Compound Name | 4-[3-[(2,5-dimethylphenyl)methoxy]phenyl]-3-phenyl-8-(trifluoromethyl)quinoline |
| PubChem CID | 66914032 |
| Molecular Formula | C31H24F3NO |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 4-[3-[(2,5-dimethylphenyl)methoxy]phenyl]-3-phenyl-8-(trifluoromethyl)quinoline |
| SMILES | Cc1ccc(C)c(COc2cccc(-c3c(-c4ccccc4)cnc4c(C(F)(F)F)cccc34)c2)c1 |
| InChI | InChI=1S/C31H24F3NO/c1-20-14-15-21(2)24(16-20)19-36-25-11-6-10-23(17-25)29-26-12-7-13-28(31(32,33)34)30(26)35-18-27(29)22-8-4-3-5-9-22/h3-18H,19H2,1-2H3 |
| InChIKey | PCUVHCPPBUYCIL-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[3-[(2,5-dimethylphenyl)methoxy]phenyl]-3-phenyl-8-(trifluoromethyl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[(2,5-dimethylphenyl)methoxy]phenyl]-3-phenyl-8-(trifluoromethyl)quinoline?
The IUPAC name of 4-[3-[(2,5-dimethylphenyl)methoxy]phenyl]-3-phenyl-8-(trifluoromethyl)quinoline (CID 66914032) is 4-[3-[(2,5-dimethylphenyl)methoxy]phenyl]-3-phenyl-8-(trifluoromethyl)quinoline.
What is the SMILES notation for 4-[3-[(2,5-dimethylphenyl)methoxy]phenyl]-3-phenyl-8-(trifluoromethyl)quinoline?
The canonical SMILES for 4-[3-[(2,5-dimethylphenyl)methoxy]phenyl]-3-phenyl-8-(trifluoromethyl)quinoline is Cc1ccc(C)c(COc2cccc(-c3c(-c4ccccc4)cnc4c(C(F)(F)F)cccc34)c2)c1.
What is the InChIKey of 4-[3-[(2,5-dimethylphenyl)methoxy]phenyl]-3-phenyl-8-(trifluoromethyl)quinoline?
The InChIKey is PCUVHCPPBUYCIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H24F3NO/c1-20-14-15-21(2)24(16-20)19-36-25-11-6-10-23(17-25)29-26-12-7-13-28(31(32,33)34)30(26)35-18-27(29)22-8-4-3-5-9-22/h3-18H,19H2,1-2H3.
What are the key properties of 4-[3-[(2,5-dimethylphenyl)methoxy]phenyl]-3-phenyl-8-(trifluoromethyl)quinoline?
4-[3-[(2,5-dimethylphenyl)methoxy]phenyl]-3-phenyl-8-(trifluoromethyl)quinoline has a molecular weight of 483.53 g/mol, XLogP of 8.78, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[(2,5-dimethylphenyl)methoxy]phenyl]-3-phenyl-8-(trifluoromethyl)quinoline is sourced from PubChem (CID 66914032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).