C19H18N2O4 — CID 66914690
ethyl 8-(3,5-dimethoxyphenyl)quinoxaline-5-carboxylate (PubChem CID 66914690) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is ethyl 8-(3,5-dimethoxyphenyl)quinoxaline-5-carboxylate.
| Compound Name | ethyl 8-(3,5-dimethoxyphenyl)quinoxaline-5-carboxylate |
|---|---|
| PubChem CID | 66914690 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | ethyl 8-(3,5-dimethoxyphenyl)quinoxaline-5-carboxylate |
| SMILES | CCOC(=O)c1ccc(-c2cc(OC)cc(OC)c2)c2nccnc12 |
| InChI | InChI=1S/C19H18N2O4/c1-4-25-19(22)16-6-5-15(17-18(16)21-8-7-20-17)12-9-13(23-2)11-14(10-12)24-3/h5-11H,4H2,1-3H3 |
| InChIKey | PKKFJKPQLUFPDF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |