C42H39F3N8O2S3 — CID 66915169
N,N'-bis[3-[2-tert-butyl-5-(2-methylpyrimidin-4-yl)-1,3-thiazol-4-yl]-2-fluorophenyl]-3-fluorobenzenesulfonohydrazide (PubChem CID 66915169) has the molecular formula C42H39F3N8O2S3 and a molecular weight of 841.02 g/mol. Its IUPAC name is N,N'-bis[3-[2-tert-butyl-5-(2-methylpyrimidin-4-yl)-1,3-thiazol-4-yl]-2-fluorophenyl]-3-fluorobenzenesulfonohydrazide.
| Compound Name | N,N'-bis[3-[2-tert-butyl-5-(2-methylpyrimidin-4-yl)-1,3-thiazol-4-yl]-2-fluorophenyl]-3-fluorobenzenesulfonohydrazide |
|---|---|
| PubChem CID | 66915169 |
| Molecular Formula | C42H39F3N8O2S3 |
| Molecular Weight | 841.02 g/mol |
| Exact Mass | 840.23 |
| IUPAC Name | N,N'-bis[3-[2-tert-butyl-5-(2-methylpyrimidin-4-yl)-1,3-thiazol-4-yl]-2-fluorophenyl]-3-fluorobenzenesulfonohydrazide |
| SMILES | Cc1nccc(-c2sc(C(C)(C)C)nc2-c2cccc(NN(c3cccc(-c4nc(C(C)(C)C)sc4-c4ccnc(C)n4)c3F)S(=O)(=O)c3cccc(F)c3)c2F)n1 |
| InChI | InChI=1S/C42H39F3N8O2S3/c1-23-46-20-18-30(48-23)37-35(50-39(56-37)41(3,4)5)27-14-10-16-29(33(27)44)52-53(58(54,55)26-13-9-12-25(43)22-26)32-17-11-15-28(34(32)45)36-38(31-19-21-47-24(2)49-31)57-40(51-36)42(6,7)8/h9-22,52H,1-8H3 |
| InChIKey | CKSOGQFBXKFTEZ-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 126.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.02 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|