C25H27N5O5 — CID 66915220
4-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-5-ethoxy-2-methylidene-5-oxopentanoic acid (PubChem CID 66915220) has the molecular formula C25H27N5O5 and a molecular weight of 477.52 g/mol. Its IUPAC name is 4-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-5-ethoxy-2-methylidene-5-oxopentanoic acid.
| Compound Name | 4-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-5-ethoxy-2-methylidene-5-oxopentanoic acid |
|---|---|
| PubChem CID | 66915220 |
| Molecular Formula | C25H27N5O5 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 4-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-5-ethoxy-2-methylidene-5-oxopentanoic acid |
| SMILES | C=C(CC(NC(=O)c1ccc(CCc2ccc3nc(N)nc(N)c3c2)cc1)C(=O)OCC)C(=O)O |
| InChI | InChI=1S/C25H27N5O5/c1-3-35-24(34)20(12-14(2)23(32)33)28-22(31)17-9-6-15(7-10-17)4-5-16-8-11-19-18(13-16)21(26)30-25(27)29-19/h6-11,13,20H,2-5,12H2,1H3,(H,28,31)(H,32,33)(H4,26,27,29,30) |
| InChIKey | NTZAGXDPVXJAKX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 170.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|