About 9-phenoxy-9H-xanthene
9-phenoxy-9H-xanthene (PubChem CID 66915285) has the molecular formula C19H14O2
and a molecular weight of 274.32 g/mol. Its IUPAC name is 9-phenoxy-9H-xanthene.
Molecular Properties
| Compound Name | 9-phenoxy-9H-xanthene |
| PubChem CID | 66915285 |
| Molecular Formula | C19H14O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 9-phenoxy-9H-xanthene |
| SMILES | c1ccc(OC2c3ccccc3Oc3ccccc32)cc1 |
| InChI | InChI=1S/C19H14O2/c1-2-8-14(9-3-1)20-19-15-10-4-6-12-17(15)21-18-13-7-5-11-16(18)19/h1-13,19H |
| InChIKey | XVHHLBLFOAZBRS-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-phenoxy-9H-xanthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-phenoxy-9H-xanthene?
The IUPAC name of 9-phenoxy-9H-xanthene (CID 66915285) is 9-phenoxy-9H-xanthene.
What is the SMILES notation for 9-phenoxy-9H-xanthene?
The canonical SMILES for 9-phenoxy-9H-xanthene is c1ccc(OC2c3ccccc3Oc3ccccc32)cc1.
What is the InChIKey of 9-phenoxy-9H-xanthene?
The InChIKey is XVHHLBLFOAZBRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14O2/c1-2-8-14(9-3-1)20-19-15-10-4-6-12-17(15)21-18-13-7-5-11-16(18)19/h1-13,19H.
What are the key properties of 9-phenoxy-9H-xanthene?
9-phenoxy-9H-xanthene has a molecular weight of 274.32 g/mol, XLogP of 4.96, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-phenoxy-9H-xanthene is sourced from PubChem (CID 66915285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).