C20H24BFO3 — CID 66915395
1-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-phenylethanol (PubChem CID 66915395) has the molecular formula C20H24BFO3 and a molecular weight of 342.22 g/mol. Its IUPAC name is 1-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-phenylethanol.
| Compound Name | 1-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-phenylethanol |
|---|---|
| PubChem CID | 66915395 |
| Molecular Formula | C20H24BFO3 |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 1-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-phenylethanol |
| SMILES | CC(O)(c1ccccc1)c1ccc(B2OC(C)(C)C(C)(C)O2)c(F)c1 |
| InChI | InChI=1S/C20H24BFO3/c1-18(2)19(3,4)25-21(24-18)16-12-11-15(13-17(16)22)20(5,23)14-9-7-6-8-10-14/h6-13,23H,1-5H3 |
| InChIKey | ONYNQIIQAJKWRQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|