About 3-(4-bromocyclohexa-2,4-dien-1-yl)prop-2-enoic acid
3-(4-bromocyclohexa-2,4-dien-1-yl)prop-2-enoic acid (PubChem CID 66915482) has the molecular formula C9H9BrO2
and a molecular weight of 229.07 g/mol. Its IUPAC name is 3-(4-bromocyclohexa-2,4-dien-1-yl)prop-2-enoic acid.
Molecular Properties
| Compound Name | 3-(4-bromocyclohexa-2,4-dien-1-yl)prop-2-enoic acid |
| PubChem CID | 66915482 |
| Molecular Formula | C9H9BrO2 |
| Molecular Weight | 229.07 g/mol |
| Exact Mass | 227.98 |
| IUPAC Name | 3-(4-bromocyclohexa-2,4-dien-1-yl)prop-2-enoic acid |
| SMILES | O=C(O)C=CC1C=CC(Br)=CC1 |
| InChI | InChI=1S/C9H9BrO2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1,3-7H,2H2,(H,11,12) |
| InChIKey | MLUQNUHUQNCDEL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.07 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-bromocyclohexa-2,4-dien-1-yl)prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromocyclohexa-2,4-dien-1-yl)prop-2-enoic acid?
The IUPAC name of 3-(4-bromocyclohexa-2,4-dien-1-yl)prop-2-enoic acid (CID 66915482) is 3-(4-bromocyclohexa-2,4-dien-1-yl)prop-2-enoic acid.
What is the SMILES notation for 3-(4-bromocyclohexa-2,4-dien-1-yl)prop-2-enoic acid?
The canonical SMILES for 3-(4-bromocyclohexa-2,4-dien-1-yl)prop-2-enoic acid is O=C(O)C=CC1C=CC(Br)=CC1.
What is the InChIKey of 3-(4-bromocyclohexa-2,4-dien-1-yl)prop-2-enoic acid?
The InChIKey is MLUQNUHUQNCDEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrO2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1,3-7H,2H2,(H,11,12).
What are the key properties of 3-(4-bromocyclohexa-2,4-dien-1-yl)prop-2-enoic acid?
3-(4-bromocyclohexa-2,4-dien-1-yl)prop-2-enoic acid has a molecular weight of 229.07 g/mol, XLogP of 2.48, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromocyclohexa-2,4-dien-1-yl)prop-2-enoic acid is sourced from PubChem (CID 66915482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).