About 3-(3,3-difluorocyclobutyl)-1-iodoimidazo[1,5-a]pyrazin-8-amine
3-(3,3-difluorocyclobutyl)-1-iodoimidazo[1,5-a]pyrazin-8-amine (PubChem CID 66915553) has the molecular formula C10H9F2IN4
and a molecular weight of 350.11 g/mol. Its IUPAC name is 3-(3,3-difluorocyclobutyl)-1-iodoimidazo[1,5-a]pyrazin-8-amine.
Molecular Properties
| Compound Name | 3-(3,3-difluorocyclobutyl)-1-iodoimidazo[1,5-a]pyrazin-8-amine |
| PubChem CID | 66915553 |
| Molecular Formula | C10H9F2IN4 |
| Molecular Weight | 350.11 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | 3-(3,3-difluorocyclobutyl)-1-iodoimidazo[1,5-a]pyrazin-8-amine |
| SMILES | Nc1nccn2c(C3CC(F)(F)C3)nc(I)c12 |
| InChI | InChI=1S/C10H9F2IN4/c11-10(12)3-5(4-10)9-16-7(13)6-8(14)15-1-2-17(6)9/h1-2,5H,3-4H2,(H2,14,15) |
| InChIKey | RZVPIMDEAZCGAW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.11 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,3-difluorocyclobutyl)-1-iodoimidazo[1,5-a]pyrazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3-difluorocyclobutyl)-1-iodoimidazo[1,5-a]pyrazin-8-amine?
The IUPAC name of 3-(3,3-difluorocyclobutyl)-1-iodoimidazo[1,5-a]pyrazin-8-amine (CID 66915553) is 3-(3,3-difluorocyclobutyl)-1-iodoimidazo[1,5-a]pyrazin-8-amine.
What is the SMILES notation for 3-(3,3-difluorocyclobutyl)-1-iodoimidazo[1,5-a]pyrazin-8-amine?
The canonical SMILES for 3-(3,3-difluorocyclobutyl)-1-iodoimidazo[1,5-a]pyrazin-8-amine is Nc1nccn2c(C3CC(F)(F)C3)nc(I)c12.
What is the InChIKey of 3-(3,3-difluorocyclobutyl)-1-iodoimidazo[1,5-a]pyrazin-8-amine?
The InChIKey is RZVPIMDEAZCGAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F2IN4/c11-10(12)3-5(4-10)9-16-7(13)6-8(14)15-1-2-17(6)9/h1-2,5H,3-4H2,(H2,14,15).
What are the key properties of 3-(3,3-difluorocyclobutyl)-1-iodoimidazo[1,5-a]pyrazin-8-amine?
3-(3,3-difluorocyclobutyl)-1-iodoimidazo[1,5-a]pyrazin-8-amine has a molecular weight of 350.11 g/mol, XLogP of 2.43, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-difluorocyclobutyl)-1-iodoimidazo[1,5-a]pyrazin-8-amine is sourced from PubChem (CID 66915553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).