C19H20BFO3 — CID 66915680
[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-phenylmethanone (PubChem CID 66915680) has the molecular formula C19H20BFO3 and a molecular weight of 326.18 g/mol. Its IUPAC name is [3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-phenylmethanone.
| Compound Name | [3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 66915680 |
| Molecular Formula | C19H20BFO3 |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | [3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-phenylmethanone |
| SMILES | CC1(C)OB(c2ccc(C(=O)c3ccccc3)cc2F)OC1(C)C |
| InChI | InChI=1S/C19H20BFO3/c1-18(2)19(3,4)24-20(23-18)15-11-10-14(12-16(15)21)17(22)13-8-6-5-7-9-13/h5-12H,1-4H3 |
| InChIKey | MQEIQJVNHNFOTR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|