C14H22O5 — CID 66915906
(1R,2S,6S,8S,9R)-4,4,11,11-tetramethyl-8-prop-1-en-2-yl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 66915906) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is (1R,2S,6S,8S,9R)-4,4,11,11-tetramethyl-8-prop-1-en-2-yl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (1R,2S,6S,8S,9R)-4,4,11,11-tetramethyl-8-prop-1-en-2-yl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 66915906 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | (1R,2S,6S,8S,9R)-4,4,11,11-tetramethyl-8-prop-1-en-2-yl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | C=C(C)[C@@H]1O[C@H]2OC(C)(C)O[C@H]2[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C14H22O5/c1-7(2)8-9-10(17-13(3,4)16-9)11-12(15-8)19-14(5,6)18-11/h8-12H,1H2,2-6H3/t8-,9+,10+,11-,12-/m0/s1 |
| InChIKey | MMTWRDOVCVNRCR-KNZXXDILSA-N |
| XLogP | 1.96 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|