About 2,2,6,6-tetraethyloxasilinane
2,2,6,6-tetraethyloxasilinane (PubChem CID 66915932) has the molecular formula C12H26OSi
and a molecular weight of 214.42 g/mol. Its IUPAC name is 2,2,6,6-tetraethyloxasilinane.
Molecular Properties
| Compound Name | 2,2,6,6-tetraethyloxasilinane |
| PubChem CID | 66915932 |
| Molecular Formula | C12H26OSi |
| Molecular Weight | 214.42 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | 2,2,6,6-tetraethyloxasilinane |
| SMILES | CCC1(CC)CCC[Si](CC)(CC)O1 |
| InChI | InChI=1S/C12H26OSi/c1-5-12(6-2)10-9-11-14(7-3,8-4)13-12/h5-11H2,1-4H3 |
| InChIKey | JQQDMWDRTHRYKX-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,2,6,6-tetraethyloxasilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,6,6-tetraethyloxasilinane?
The IUPAC name of 2,2,6,6-tetraethyloxasilinane (CID 66915932) is 2,2,6,6-tetraethyloxasilinane.
What is the SMILES notation for 2,2,6,6-tetraethyloxasilinane?
The canonical SMILES for 2,2,6,6-tetraethyloxasilinane is CCC1(CC)CCC[Si](CC)(CC)O1.
What is the InChIKey of 2,2,6,6-tetraethyloxasilinane?
The InChIKey is JQQDMWDRTHRYKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26OSi/c1-5-12(6-2)10-9-11-14(7-3,8-4)13-12/h5-11H2,1-4H3.
What are the key properties of 2,2,6,6-tetraethyloxasilinane?
2,2,6,6-tetraethyloxasilinane has a molecular weight of 214.42 g/mol, XLogP of 4.34, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,6,6-tetraethyloxasilinane is sourced from PubChem (CID 66915932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).