C16H22O2 — CID 66916420
2-benzyl-4-methyl-4a,5,6,7,8,8a-hexahydro-4H-benzo[d][1,3]dioxine (PubChem CID 66916420) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is 2-benzyl-4-methyl-4a,5,6,7,8,8a-hexahydro-4H-benzo[d][1,3]dioxine.
| Compound Name | 2-benzyl-4-methyl-4a,5,6,7,8,8a-hexahydro-4H-benzo[d][1,3]dioxine |
|---|---|
| PubChem CID | 66916420 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 2-benzyl-4-methyl-4a,5,6,7,8,8a-hexahydro-4H-benzo[d][1,3]dioxine |
| SMILES | CC1OC(Cc2ccccc2)OC2CCCCC12 |
| InChI | InChI=1S/C16H22O2/c1-12-14-9-5-6-10-15(14)18-16(17-12)11-13-7-3-2-4-8-13/h2-4,7-8,12,14-16H,5-6,9-11H2,1H3 |
| InChIKey | MNBLGXDUGKWAQZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |