C12H18O2 — CID 66916438
4-methyl-2-prop-1-enyl-4a,5,6,7-tetrahydro-4H-1,3-benzodioxine (PubChem CID 66916438) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 4-methyl-2-prop-1-enyl-4a,5,6,7-tetrahydro-4H-1,3-benzodioxine.
| Compound Name | 4-methyl-2-prop-1-enyl-4a,5,6,7-tetrahydro-4H-1,3-benzodioxine |
|---|---|
| PubChem CID | 66916438 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 4-methyl-2-prop-1-enyl-4a,5,6,7-tetrahydro-4H-1,3-benzodioxine |
| SMILES | CC=CC1OC2=CCCCC2C(C)O1 |
| InChI | InChI=1S/C12H18O2/c1-3-6-12-13-9(2)10-7-4-5-8-11(10)14-12/h3,6,8-10,12H,4-5,7H2,1-2H3 |
| InChIKey | AYNBDRSQVMUVQJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|