C10H20ClN4O3+ — CID 66916510
4-(1,2-dimethoxy-2H-1,3,5-triazin-4-yl)-4-methylmorpholin-4-ium;hydrochloride (PubChem CID 66916510) has the molecular formula C10H20ClN4O3+ and a molecular weight of 279.75 g/mol. Its IUPAC name is 4-(1,2-dimethoxy-2H-1,3,5-triazin-4-yl)-4-methylmorpholin-4-ium;hydrochloride.
| Compound Name | 4-(1,2-dimethoxy-2H-1,3,5-triazin-4-yl)-4-methylmorpholin-4-ium;hydrochloride |
|---|---|
| PubChem CID | 66916510 |
| Molecular Formula | C10H20ClN4O3+ |
| Molecular Weight | 279.75 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 4-(1,2-dimethoxy-2H-1,3,5-triazin-4-yl)-4-methylmorpholin-4-ium;hydrochloride |
| SMILES | COC1N=C([N+]2(C)CCOCC2)N=CN1OC.Cl |
| InChI | InChI=1S/C10H19N4O3.ClH/c1-14(4-6-17-7-5-14)9-11-8-13(16-3)10(12-9)15-2;/h8,10H,4-7H2,1-3H3;1H/q+1; |
| InChIKey | CTQHNHKWMORZCE-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 55.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.75 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|