C10H19N4O3+ — CID 66916511
4-(1,2-dimethoxy-2H-1,3,5-triazin-4-yl)-4-methylmorpholin-4-ium (PubChem CID 66916511) has the molecular formula C10H19N4O3+ and a molecular weight of 243.29 g/mol. Its IUPAC name is 4-(1,2-dimethoxy-2H-1,3,5-triazin-4-yl)-4-methylmorpholin-4-ium.
| Compound Name | 4-(1,2-dimethoxy-2H-1,3,5-triazin-4-yl)-4-methylmorpholin-4-ium |
|---|---|
| PubChem CID | 66916511 |
| Molecular Formula | C10H19N4O3+ |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 4-(1,2-dimethoxy-2H-1,3,5-triazin-4-yl)-4-methylmorpholin-4-ium |
| SMILES | COC1N=C([N+]2(C)CCOCC2)N=CN1OC |
| InChI | InChI=1S/C10H19N4O3/c1-14(4-6-17-7-5-14)9-11-8-13(16-3)10(12-9)15-2/h8,10H,4-7H2,1-3H3/q+1 |
| InChIKey | WYCJDLKJWDKXBD-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 55.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|