C14H22O2 — CID 66916573
4,6,6-trimethyl-2-prop-1-enyl-4,4a,5,7-tetrahydro-1,3-benzodioxine (PubChem CID 66916573) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 4,6,6-trimethyl-2-prop-1-enyl-4,4a,5,7-tetrahydro-1,3-benzodioxine.
| Compound Name | 4,6,6-trimethyl-2-prop-1-enyl-4,4a,5,7-tetrahydro-1,3-benzodioxine |
|---|---|
| PubChem CID | 66916573 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 4,6,6-trimethyl-2-prop-1-enyl-4,4a,5,7-tetrahydro-1,3-benzodioxine |
| SMILES | CC=CC1OC2=CCC(C)(C)CC2C(C)O1 |
| InChI | InChI=1S/C14H22O2/c1-5-6-13-15-10(2)11-9-14(3,4)8-7-12(11)16-13/h5-7,10-11,13H,8-9H2,1-4H3 |
| InChIKey | BBOPQYQTBSRENG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|