C15H18O2 — CID 66916594
4-methyl-2-phenyl-4a,5,6,7-tetrahydro-4H-1,3-benzodioxine (PubChem CID 66916594) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 4-methyl-2-phenyl-4a,5,6,7-tetrahydro-4H-1,3-benzodioxine.
| Compound Name | 4-methyl-2-phenyl-4a,5,6,7-tetrahydro-4H-1,3-benzodioxine |
|---|---|
| PubChem CID | 66916594 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 4-methyl-2-phenyl-4a,5,6,7-tetrahydro-4H-1,3-benzodioxine |
| SMILES | CC1OC(c2ccccc2)OC2=CCCCC21 |
| InChI | InChI=1S/C15H18O2/c1-11-13-9-5-6-10-14(13)17-15(16-11)12-7-3-2-4-8-12/h2-4,7-8,10-11,13,15H,5-6,9H2,1H3 |
| InChIKey | WGKLFQUIZBURAH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |