About quinoline-4,6-dione
quinoline-4,6-dione (PubChem CID 66916701) has the molecular formula C9H5NO2
and a molecular weight of 159.14 g/mol. Its IUPAC name is quinoline-4,6-dione.
Molecular Properties
| Compound Name | quinoline-4,6-dione |
| PubChem CID | 66916701 |
| Molecular Formula | C9H5NO2 |
| Molecular Weight | 159.14 g/mol |
| Exact Mass | 159.03 |
| IUPAC Name | quinoline-4,6-dione |
| SMILES | O=C1C=CC2=NC=CC(=O)C2=C1 |
| InChI | InChI=1S/C9H5NO2/c11-6-1-2-8-7(5-6)9(12)3-4-10-8/h1-5H |
| InChIKey | JMMPJDRIKFSMRE-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.14 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze quinoline-4,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoline-4,6-dione?
The IUPAC name of quinoline-4,6-dione (CID 66916701) is quinoline-4,6-dione.
What is the SMILES notation for quinoline-4,6-dione?
The canonical SMILES for quinoline-4,6-dione is O=C1C=CC2=NC=CC(=O)C2=C1.
What is the InChIKey of quinoline-4,6-dione?
The InChIKey is JMMPJDRIKFSMRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5NO2/c11-6-1-2-8-7(5-6)9(12)3-4-10-8/h1-5H.
What are the key properties of quinoline-4,6-dione?
quinoline-4,6-dione has a molecular weight of 159.14 g/mol, XLogP of 0.59, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for quinoline-4,6-dione is sourced from PubChem (CID 66916701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).