About 2,3-dihydroxypropyl (2-phenylhydrazinyl) carbonate
2,3-dihydroxypropyl (2-phenylhydrazinyl) carbonate (PubChem CID 66916810) has the molecular formula C10H14N2O5
and a molecular weight of 242.23 g/mol. Its IUPAC name is 2,3-dihydroxypropyl (2-phenylhydrazinyl) carbonate.
Molecular Properties
| Compound Name | 2,3-dihydroxypropyl (2-phenylhydrazinyl) carbonate |
| PubChem CID | 66916810 |
| Molecular Formula | C10H14N2O5 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2,3-dihydroxypropyl (2-phenylhydrazinyl) carbonate |
| SMILES | O=C(OCC(O)CO)ONNc1ccccc1 |
| InChI | InChI=1S/C10H14N2O5/c13-6-9(14)7-16-10(15)17-12-11-8-4-2-1-3-5-8/h1-5,9,11-14H,6-7H2 |
| InChIKey | OJHCLIFKQRCAFR-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydroxypropyl (2-phenylhydrazinyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxypropyl (2-phenylhydrazinyl) carbonate?
The IUPAC name of 2,3-dihydroxypropyl (2-phenylhydrazinyl) carbonate (CID 66916810) is 2,3-dihydroxypropyl (2-phenylhydrazinyl) carbonate.
What is the SMILES notation for 2,3-dihydroxypropyl (2-phenylhydrazinyl) carbonate?
The canonical SMILES for 2,3-dihydroxypropyl (2-phenylhydrazinyl) carbonate is O=C(OCC(O)CO)ONNc1ccccc1.
What is the InChIKey of 2,3-dihydroxypropyl (2-phenylhydrazinyl) carbonate?
The InChIKey is OJHCLIFKQRCAFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O5/c13-6-9(14)7-16-10(15)17-12-11-8-4-2-1-3-5-8/h1-5,9,11-14H,6-7H2.
What are the key properties of 2,3-dihydroxypropyl (2-phenylhydrazinyl) carbonate?
2,3-dihydroxypropyl (2-phenylhydrazinyl) carbonate has a molecular weight of 242.23 g/mol, XLogP of 0.02, 6 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxypropyl (2-phenylhydrazinyl) carbonate is sourced from PubChem (CID 66916810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).