C22H41N3O — CID 66916841
(4aR,8aS)-1-[1-[4-(ethoxymethyl)cyclohexyl]piperidin-4-yl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinazoline (PubChem CID 66916841) has the molecular formula C22H41N3O and a molecular weight of 363.59 g/mol. Its IUPAC name is (4aR,8aS)-1-[1-[4-(ethoxymethyl)cyclohexyl]piperidin-4-yl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinazoline.
| Compound Name | (4aR,8aS)-1-[1-[4-(ethoxymethyl)cyclohexyl]piperidin-4-yl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinazoline |
|---|---|
| PubChem CID | 66916841 |
| Molecular Formula | C22H41N3O |
| Molecular Weight | 363.59 g/mol |
| Exact Mass | 363.32 |
| IUPAC Name | (4aR,8aS)-1-[1-[4-(ethoxymethyl)cyclohexyl]piperidin-4-yl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinazoline |
| SMILES | CCOCC1CCC(N2CCC(N3CNC[C@H]4CCCC[C@@H]43)CC2)CC1 |
| InChI | InChI=1S/C22H41N3O/c1-2-26-16-18-7-9-20(10-8-18)24-13-11-21(12-14-24)25-17-23-15-19-5-3-4-6-22(19)25/h18-23H,2-17H2,1H3/t18?,19-,20?,22+/m1/s1 |
| InChIKey | IEOWJOHIENBREI-VYIQXXGSSA-N |
| XLogP | 3.47 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.59 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |