C31H30FN7O4 — CID 66917586
(2R)-1-N-[3-fluoro-4-[[3-(6-piperazin-1-yl-3-pyridinyl)-4-pyridinyl]oxy]phenyl]-2-phenylethane-1,1,2-tricarboxamide (PubChem CID 66917586) has the molecular formula C31H30FN7O4 and a molecular weight of 583.62 g/mol. Its IUPAC name is (2R)-1-N-[3-fluoro-4-[[3-(6-piperazin-1-yl-3-pyridinyl)-4-pyridinyl]oxy]phenyl]-2-phenylethane-1,1,2-tricarboxamide.
| Compound Name | (2R)-1-N-[3-fluoro-4-[[3-(6-piperazin-1-yl-3-pyridinyl)-4-pyridinyl]oxy]phenyl]-2-phenylethane-1,1,2-tricarboxamide |
|---|---|
| PubChem CID | 66917586 |
| Molecular Formula | C31H30FN7O4 |
| Molecular Weight | 583.62 g/mol |
| Exact Mass | 583.23 |
| IUPAC Name | (2R)-1-N-[3-fluoro-4-[[3-(6-piperazin-1-yl-3-pyridinyl)-4-pyridinyl]oxy]phenyl]-2-phenylethane-1,1,2-tricarboxamide |
| SMILES | NC(=O)C(C(=O)Nc1ccc(Oc2ccncc2-c2ccc(N3CCNCC3)nc2)c(F)c1)[C@@H](C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C31H30FN7O4/c32-23-16-21(38-31(42)28(30(34)41)27(29(33)40)19-4-2-1-3-5-19)7-8-25(23)43-24-10-11-36-18-22(24)20-6-9-26(37-17-20)39-14-12-35-13-15-39/h1-11,16-18,27-28,35H,12-15H2,(H2,33,40)(H2,34,41)(H,38,42)/t27-,28?/m0/s1 |
| InChIKey | VBGGKVVEWBYBLC-MBMZGMDYSA-N |
| XLogP | 2.79 |
| TPSA | 165.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.62 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|