C24H25NO3 — CID 66917703
methyl 3-[3a-methyl-1-(naphthalen-2-ylmethyl)-2-oxo-3,4,5,6-tetrahydroindol-7-yl]prop-2-enoate (PubChem CID 66917703) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is methyl 3-[3a-methyl-1-(naphthalen-2-ylmethyl)-2-oxo-3,4,5,6-tetrahydroindol-7-yl]prop-2-enoate.
| Compound Name | methyl 3-[3a-methyl-1-(naphthalen-2-ylmethyl)-2-oxo-3,4,5,6-tetrahydroindol-7-yl]prop-2-enoate |
|---|---|
| PubChem CID | 66917703 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | methyl 3-[3a-methyl-1-(naphthalen-2-ylmethyl)-2-oxo-3,4,5,6-tetrahydroindol-7-yl]prop-2-enoate |
| SMILES | COC(=O)C=CC1=C2N(Cc3ccc4ccccc4c3)C(=O)CC2(C)CCC1 |
| InChI | InChI=1S/C24H25NO3/c1-24-13-5-8-19(11-12-22(27)28-2)23(24)25(21(26)15-24)16-17-9-10-18-6-3-4-7-20(18)14-17/h3-4,6-7,9-12,14H,5,8,13,15-16H2,1-2H3 |
| InChIKey | UDXGRUCPAPFHLS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|