C20H21F2NO3 — CID 66917755
methyl (E)-3-[1-[(3,4-difluorophenyl)methyl]-3a-methyl-2-oxo-3,4,5,6-tetrahydroindol-7-yl]prop-2-enoate (PubChem CID 66917755) has the molecular formula C20H21F2NO3 and a molecular weight of 361.39 g/mol. Its IUPAC name is methyl (E)-3-[1-[(3,4-difluorophenyl)methyl]-3a-methyl-2-oxo-3,4,5,6-tetrahydroindol-7-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[1-[(3,4-difluorophenyl)methyl]-3a-methyl-2-oxo-3,4,5,6-tetrahydroindol-7-yl]prop-2-enoate |
|---|---|
| PubChem CID | 66917755 |
| Molecular Formula | C20H21F2NO3 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | methyl (E)-3-[1-[(3,4-difluorophenyl)methyl]-3a-methyl-2-oxo-3,4,5,6-tetrahydroindol-7-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/C1=C2N(Cc3ccc(F)c(F)c3)C(=O)CC2(C)CCC1 |
| InChI | InChI=1S/C20H21F2NO3/c1-20-9-3-4-14(6-8-18(25)26-2)19(20)23(17(24)11-20)12-13-5-7-15(21)16(22)10-13/h5-8,10H,3-4,9,11-12H2,1-2H3/b8-6+ |
| InChIKey | HJUCIROPZIEYTD-SOFGYWHQSA-N |
| XLogP | 3.87 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|