About ethyl 1-[(2,4-dichlorophenyl)methyl]-5-fluoro-3-methylindole-7-carboxylate
ethyl 1-[(2,4-dichlorophenyl)methyl]-5-fluoro-3-methylindole-7-carboxylate (PubChem CID 66917772) has the molecular formula C19H16Cl2FNO2
and a molecular weight of 380.25 g/mol. Its IUPAC name is ethyl 1-[(2,4-dichlorophenyl)methyl]-5-fluoro-3-methylindole-7-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[(2,4-dichlorophenyl)methyl]-5-fluoro-3-methylindole-7-carboxylate |
| PubChem CID | 66917772 |
| Molecular Formula | C19H16Cl2FNO2 |
| Molecular Weight | 380.25 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | ethyl 1-[(2,4-dichlorophenyl)methyl]-5-fluoro-3-methylindole-7-carboxylate |
| SMILES | CCOC(=O)c1cc(F)cc2c(C)cn(Cc3ccc(Cl)cc3Cl)c12 |
| InChI | InChI=1S/C19H16Cl2FNO2/c1-3-25-19(24)16-8-14(22)7-15-11(2)9-23(18(15)16)10-12-4-5-13(20)6-17(12)21/h4-9H,3,10H2,1-2H3 |
| InChIKey | SITZHEZDXHTUIP-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.25 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 1-[(2,4-dichlorophenyl)methyl]-5-fluoro-3-methylindole-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[(2,4-dichlorophenyl)methyl]-5-fluoro-3-methylindole-7-carboxylate?
The IUPAC name of ethyl 1-[(2,4-dichlorophenyl)methyl]-5-fluoro-3-methylindole-7-carboxylate (CID 66917772) is ethyl 1-[(2,4-dichlorophenyl)methyl]-5-fluoro-3-methylindole-7-carboxylate.
What is the SMILES notation for ethyl 1-[(2,4-dichlorophenyl)methyl]-5-fluoro-3-methylindole-7-carboxylate?
The canonical SMILES for ethyl 1-[(2,4-dichlorophenyl)methyl]-5-fluoro-3-methylindole-7-carboxylate is CCOC(=O)c1cc(F)cc2c(C)cn(Cc3ccc(Cl)cc3Cl)c12.
What is the InChIKey of ethyl 1-[(2,4-dichlorophenyl)methyl]-5-fluoro-3-methylindole-7-carboxylate?
The InChIKey is SITZHEZDXHTUIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16Cl2FNO2/c1-3-25-19(24)16-8-14(22)7-15-11(2)9-23(18(15)16)10-12-4-5-13(20)6-17(12)21/h4-9H,3,10H2,1-2H3.
What are the key properties of ethyl 1-[(2,4-dichlorophenyl)methyl]-5-fluoro-3-methylindole-7-carboxylate?
ethyl 1-[(2,4-dichlorophenyl)methyl]-5-fluoro-3-methylindole-7-carboxylate has a molecular weight of 380.25 g/mol, XLogP of 5.62, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[(2,4-dichlorophenyl)methyl]-5-fluoro-3-methylindole-7-carboxylate is sourced from PubChem (CID 66917772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).