C20H25F2NO3 — CID 66917805
methyl 3-[1-[(3,4-difluorophenyl)methyl]-3a-methyl-2-oxo-3,4,5,6,7,7a-hexahydroindol-7-yl]propanoate (PubChem CID 66917805) has the molecular formula C20H25F2NO3 and a molecular weight of 365.42 g/mol. Its IUPAC name is methyl 3-[1-[(3,4-difluorophenyl)methyl]-3a-methyl-2-oxo-3,4,5,6,7,7a-hexahydroindol-7-yl]propanoate.
| Compound Name | methyl 3-[1-[(3,4-difluorophenyl)methyl]-3a-methyl-2-oxo-3,4,5,6,7,7a-hexahydroindol-7-yl]propanoate |
|---|---|
| PubChem CID | 66917805 |
| Molecular Formula | C20H25F2NO3 |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | methyl 3-[1-[(3,4-difluorophenyl)methyl]-3a-methyl-2-oxo-3,4,5,6,7,7a-hexahydroindol-7-yl]propanoate |
| SMILES | COC(=O)CCC1CCCC2(C)CC(=O)N(Cc3ccc(F)c(F)c3)C12 |
| InChI | InChI=1S/C20H25F2NO3/c1-20-9-3-4-14(6-8-18(25)26-2)19(20)23(17(24)11-20)12-13-5-7-15(21)16(22)10-13/h5,7,10,14,19H,3-4,6,8-9,11-12H2,1-2H3 |
| InChIKey | BWCWBLQJRAEPPV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |