About (E)-N-(2,4-difluorophenyl)sulfonyl-3-(5-fluoro-3-methyl-1H-indol-7-yl)prop-2-enamide
(E)-N-(2,4-difluorophenyl)sulfonyl-3-(5-fluoro-3-methyl-1H-indol-7-yl)prop-2-enamide (PubChem CID 66917858) has the molecular formula C18H13F3N2O3S
and a molecular weight of 394.37 g/mol. Its IUPAC name is (E)-N-(2,4-difluorophenyl)sulfonyl-3-(5-fluoro-3-methyl-1H-indol-7-yl)prop-2-enamide.
Molecular Properties
| Compound Name | (E)-N-(2,4-difluorophenyl)sulfonyl-3-(5-fluoro-3-methyl-1H-indol-7-yl)prop-2-enamide |
| PubChem CID | 66917858 |
| Molecular Formula | C18H13F3N2O3S |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | (E)-N-(2,4-difluorophenyl)sulfonyl-3-(5-fluoro-3-methyl-1H-indol-7-yl)prop-2-enamide |
| SMILES | Cc1c[nH]c2c(/C=C/C(=O)NS(=O)(=O)c3ccc(F)cc3F)cc(F)cc12 |
| InChI | InChI=1S/C18H13F3N2O3S/c1-10-9-22-18-11(6-13(20)7-14(10)18)2-5-17(24)23-27(25,26)16-4-3-12(19)8-15(16)21/h2-9,22H,1H3,(H,23,24)/b5-2+ |
| InChIKey | SXAHPWUJNONESX-GORDUTHDSA-N |
| XLogP | 3.41 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-(2,4-difluorophenyl)sulfonyl-3-(5-fluoro-3-methyl-1H-indol-7-yl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-(2,4-difluorophenyl)sulfonyl-3-(5-fluoro-3-methyl-1H-indol-7-yl)prop-2-enamide?
The IUPAC name of (E)-N-(2,4-difluorophenyl)sulfonyl-3-(5-fluoro-3-methyl-1H-indol-7-yl)prop-2-enamide (CID 66917858) is (E)-N-(2,4-difluorophenyl)sulfonyl-3-(5-fluoro-3-methyl-1H-indol-7-yl)prop-2-enamide.
What is the SMILES notation for (E)-N-(2,4-difluorophenyl)sulfonyl-3-(5-fluoro-3-methyl-1H-indol-7-yl)prop-2-enamide?
The canonical SMILES for (E)-N-(2,4-difluorophenyl)sulfonyl-3-(5-fluoro-3-methyl-1H-indol-7-yl)prop-2-enamide is Cc1c[nH]c2c(/C=C/C(=O)NS(=O)(=O)c3ccc(F)cc3F)cc(F)cc12.
What is the InChIKey of (E)-N-(2,4-difluorophenyl)sulfonyl-3-(5-fluoro-3-methyl-1H-indol-7-yl)prop-2-enamide?
The InChIKey is SXAHPWUJNONESX-GORDUTHDSA-N. The full InChI is InChI=1S/C18H13F3N2O3S/c1-10-9-22-18-11(6-13(20)7-14(10)18)2-5-17(24)23-27(25,26)16-4-3-12(19)8-15(16)21/h2-9,22H,1H3,(H,23,24)/b5-2+.
What are the key properties of (E)-N-(2,4-difluorophenyl)sulfonyl-3-(5-fluoro-3-methyl-1H-indol-7-yl)prop-2-enamide?
(E)-N-(2,4-difluorophenyl)sulfonyl-3-(5-fluoro-3-methyl-1H-indol-7-yl)prop-2-enamide has a molecular weight of 394.37 g/mol, XLogP of 3.41, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-(2,4-difluorophenyl)sulfonyl-3-(5-fluoro-3-methyl-1H-indol-7-yl)prop-2-enamide is sourced from PubChem (CID 66917858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).