C26H34O3Si — CID 66918808
tert-butyl-[[2-(2,2-dimethylcyclopentyl)-1,3-dioxol-4-yl]oxy]-diphenylsilane (PubChem CID 66918808) has the molecular formula C26H34O3Si and a molecular weight of 422.64 g/mol. Its IUPAC name is tert-butyl-[[2-(2,2-dimethylcyclopentyl)-1,3-dioxol-4-yl]oxy]-diphenylsilane.
| Compound Name | tert-butyl-[[2-(2,2-dimethylcyclopentyl)-1,3-dioxol-4-yl]oxy]-diphenylsilane |
|---|---|
| PubChem CID | 66918808 |
| Molecular Formula | C26H34O3Si |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | tert-butyl-[[2-(2,2-dimethylcyclopentyl)-1,3-dioxol-4-yl]oxy]-diphenylsilane |
| SMILES | CC1(C)CCCC1C1OC=C(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C26H34O3Si/c1-25(2,3)30(20-13-8-6-9-14-20,21-15-10-7-11-16-21)29-23-19-27-24(28-23)22-17-12-18-26(22,4)5/h6-11,13-16,19,22,24H,12,17-18H2,1-5H3 |
| InChIKey | UNUVVCPSGRXPMW-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|