About 1-ethylpyrrole-2,5-dione;2-iodoacetamide
1-ethylpyrrole-2,5-dione;2-iodoacetamide (PubChem CID 66919154) has the molecular formula C8H11IN2O3
and a molecular weight of 310.09 g/mol. Its IUPAC name is 1-ethylpyrrole-2,5-dione;2-iodoacetamide.
Molecular Properties
| Compound Name | 1-ethylpyrrole-2,5-dione;2-iodoacetamide |
| PubChem CID | 66919154 |
| Molecular Formula | C8H11IN2O3 |
| Molecular Weight | 310.09 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | 1-ethylpyrrole-2,5-dione;2-iodoacetamide |
| SMILES | CCN1C(=O)C=CC1=O.NC(=O)CI |
| InChI | InChI=1S/C6H7NO2.C2H4INO/c1-2-7-5(8)3-4-6(7)9;3-1-2(4)5/h3-4H,2H2,1H3;1H2,(H2,4,5) |
| InChIKey | ALUNOIDAUGIFJH-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.09 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-ethylpyrrole-2,5-dione;2-iodoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylpyrrole-2,5-dione;2-iodoacetamide?
The IUPAC name of 1-ethylpyrrole-2,5-dione;2-iodoacetamide (CID 66919154) is 1-ethylpyrrole-2,5-dione;2-iodoacetamide.
What is the SMILES notation for 1-ethylpyrrole-2,5-dione;2-iodoacetamide?
The canonical SMILES for 1-ethylpyrrole-2,5-dione;2-iodoacetamide is CCN1C(=O)C=CC1=O.NC(=O)CI.
What is the InChIKey of 1-ethylpyrrole-2,5-dione;2-iodoacetamide?
The InChIKey is ALUNOIDAUGIFJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2.C2H4INO/c1-2-7-5(8)3-4-6(7)9;3-1-2(4)5/h3-4H,2H2,1H3;1H2,(H2,4,5).
What are the key properties of 1-ethylpyrrole-2,5-dione;2-iodoacetamide?
1-ethylpyrrole-2,5-dione;2-iodoacetamide has a molecular weight of 310.09 g/mol, XLogP of -0.16, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylpyrrole-2,5-dione;2-iodoacetamide is sourced from PubChem (CID 66919154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).