About 1-bromo-4-cyclopropylbenzene;N-methylmethanamine;hydrochloride
1-bromo-4-cyclopropylbenzene;N-methylmethanamine;hydrochloride (PubChem CID 66919211) has the molecular formula C11H17BrClN
and a molecular weight of 278.62 g/mol. Its IUPAC name is 1-bromo-4-cyclopropylbenzene;N-methylmethanamine;hydrochloride.
Molecular Properties
| Compound Name | 1-bromo-4-cyclopropylbenzene;N-methylmethanamine;hydrochloride |
| PubChem CID | 66919211 |
| Molecular Formula | C11H17BrClN |
| Molecular Weight | 278.62 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 1-bromo-4-cyclopropylbenzene;N-methylmethanamine;hydrochloride |
| SMILES | Brc1ccc(C2CC2)cc1.CNC.Cl |
| InChI | InChI=1S/C9H9Br.C2H7N.ClH/c10-9-5-3-8(4-6-9)7-1-2-7;1-3-2;/h3-7H,1-2H2;3H,1-2H3;1H |
| InChIKey | XXUIXOXXSJNTOY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.62 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-bromo-4-cyclopropylbenzene;N-methylmethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-cyclopropylbenzene;N-methylmethanamine;hydrochloride?
The IUPAC name of 1-bromo-4-cyclopropylbenzene;N-methylmethanamine;hydrochloride (CID 66919211) is 1-bromo-4-cyclopropylbenzene;N-methylmethanamine;hydrochloride.
What is the SMILES notation for 1-bromo-4-cyclopropylbenzene;N-methylmethanamine;hydrochloride?
The canonical SMILES for 1-bromo-4-cyclopropylbenzene;N-methylmethanamine;hydrochloride is Brc1ccc(C2CC2)cc1.CNC.Cl.
What is the InChIKey of 1-bromo-4-cyclopropylbenzene;N-methylmethanamine;hydrochloride?
The InChIKey is XXUIXOXXSJNTOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9Br.C2H7N.ClH/c10-9-5-3-8(4-6-9)7-1-2-7;1-3-2;/h3-7H,1-2H2;3H,1-2H3;1H.
What are the key properties of 1-bromo-4-cyclopropylbenzene;N-methylmethanamine;hydrochloride?
1-bromo-4-cyclopropylbenzene;N-methylmethanamine;hydrochloride has a molecular weight of 278.62 g/mol, XLogP of 3.58, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-cyclopropylbenzene;N-methylmethanamine;hydrochloride is sourced from PubChem (CID 66919211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).