About 2,3-dihydrothieno[3,4-b][1,4]dioxine;methanol
2,3-dihydrothieno[3,4-b][1,4]dioxine;methanol (PubChem CID 66919465) has the molecular formula C7H10O3S
and a molecular weight of 174.22 g/mol. Its IUPAC name is 2,3-dihydrothieno[3,4-b][1,4]dioxine;methanol.
Molecular Properties
| Compound Name | 2,3-dihydrothieno[3,4-b][1,4]dioxine;methanol |
| PubChem CID | 66919465 |
| Molecular Formula | C7H10O3S |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | 2,3-dihydrothieno[3,4-b][1,4]dioxine;methanol |
| SMILES | CO.c1scc2c1OCCO2 |
| InChI | InChI=1S/C6H6O2S.CH4O/c1-2-8-6-4-9-3-5(6)7-1;1-2/h3-4H,1-2H2;2H,1H3 |
| InChIKey | RNKDSINEPGTVCL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dihydrothieno[3,4-b][1,4]dioxine;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydrothieno[3,4-b][1,4]dioxine;methanol?
The IUPAC name of 2,3-dihydrothieno[3,4-b][1,4]dioxine;methanol (CID 66919465) is 2,3-dihydrothieno[3,4-b][1,4]dioxine;methanol.
What is the SMILES notation for 2,3-dihydrothieno[3,4-b][1,4]dioxine;methanol?
The canonical SMILES for 2,3-dihydrothieno[3,4-b][1,4]dioxine;methanol is CO.c1scc2c1OCCO2.
What is the InChIKey of 2,3-dihydrothieno[3,4-b][1,4]dioxine;methanol?
The InChIKey is RNKDSINEPGTVCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2S.CH4O/c1-2-8-6-4-9-3-5(6)7-1;1-2/h3-4H,1-2H2;2H,1H3.
What are the key properties of 2,3-dihydrothieno[3,4-b][1,4]dioxine;methanol?
2,3-dihydrothieno[3,4-b][1,4]dioxine;methanol has a molecular weight of 174.22 g/mol, XLogP of 1.13, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydrothieno[3,4-b][1,4]dioxine;methanol is sourced from PubChem (CID 66919465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).