C18H24N2O3 — CID 66919980
2-(3-hydroxy-3-methylbutyl)-5,6-dimethyl-3-[2-(1H-pyrazol-5-yl)ethyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 66919980) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-(3-hydroxy-3-methylbutyl)-5,6-dimethyl-3-[2-(1H-pyrazol-5-yl)ethyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-(3-hydroxy-3-methylbutyl)-5,6-dimethyl-3-[2-(1H-pyrazol-5-yl)ethyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 66919980 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 2-(3-hydroxy-3-methylbutyl)-5,6-dimethyl-3-[2-(1H-pyrazol-5-yl)ethyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C)C(=O)C(CCC(C)(C)O)=C(CCc2ccn[nH]2)C1=O |
| InChI | InChI=1S/C18H24N2O3/c1-11-12(2)17(22)15(7-9-18(3,4)23)14(16(11)21)6-5-13-8-10-19-20-13/h8,10,23H,5-7,9H2,1-4H3,(H,19,20) |
| InChIKey | SXRAKZWPXHMLFW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|