About (2E)-3,7-dimethyl-N-[3-(1-methylpiperidin-1-ium-1-yl)propyl]octa-2,6-dien-1-amine
(2E)-3,7-dimethyl-N-[3-(1-methylpiperidin-1-ium-1-yl)propyl]octa-2,6-dien-1-amine (PubChem CID 66920096) has the molecular formula C19H37N2+
and a molecular weight of 293.52 g/mol. Its IUPAC name is (2E)-3,7-dimethyl-N-[3-(1-methylpiperidin-1-ium-1-yl)propyl]octa-2,6-dien-1-amine.
Molecular Properties
| Compound Name | (2E)-3,7-dimethyl-N-[3-(1-methylpiperidin-1-ium-1-yl)propyl]octa-2,6-dien-1-amine |
| PubChem CID | 66920096 |
| Molecular Formula | C19H37N2+ |
| Molecular Weight | 293.52 g/mol |
| Exact Mass | 293.30 |
| IUPAC Name | (2E)-3,7-dimethyl-N-[3-(1-methylpiperidin-1-ium-1-yl)propyl]octa-2,6-dien-1-amine |
| SMILES | CC(C)=CCC/C(C)=C/CNCCC[N+]1(C)CCCCC1 |
| InChI | InChI=1S/C19H37N2/c1-18(2)10-8-11-19(3)12-14-20-13-9-17-21(4)15-6-5-7-16-21/h10,12,20H,5-9,11,13-17H2,1-4H3/q+1/b19-12+ |
| InChIKey | NFVVWQGXJQEDCX-XDHOZWIPSA-N |
| XLogP | 4.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (2E)-3,7-dimethyl-N-[3-(1-methylpiperidin-1-ium-1-yl)propyl]octa-2,6-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-3,7-dimethyl-N-[3-(1-methylpiperidin-1-ium-1-yl)propyl]octa-2,6-dien-1-amine?
The IUPAC name of (2E)-3,7-dimethyl-N-[3-(1-methylpiperidin-1-ium-1-yl)propyl]octa-2,6-dien-1-amine (CID 66920096) is (2E)-3,7-dimethyl-N-[3-(1-methylpiperidin-1-ium-1-yl)propyl]octa-2,6-dien-1-amine.
What is the SMILES notation for (2E)-3,7-dimethyl-N-[3-(1-methylpiperidin-1-ium-1-yl)propyl]octa-2,6-dien-1-amine?
The canonical SMILES for (2E)-3,7-dimethyl-N-[3-(1-methylpiperidin-1-ium-1-yl)propyl]octa-2,6-dien-1-amine is CC(C)=CCC/C(C)=C/CNCCC[N+]1(C)CCCCC1.
What is the InChIKey of (2E)-3,7-dimethyl-N-[3-(1-methylpiperidin-1-ium-1-yl)propyl]octa-2,6-dien-1-amine?
The InChIKey is NFVVWQGXJQEDCX-XDHOZWIPSA-N. The full InChI is InChI=1S/C19H37N2/c1-18(2)10-8-11-19(3)12-14-20-13-9-17-21(4)15-6-5-7-16-21/h10,12,20H,5-9,11,13-17H2,1-4H3/q+1/b19-12+.
What are the key properties of (2E)-3,7-dimethyl-N-[3-(1-methylpiperidin-1-ium-1-yl)propyl]octa-2,6-dien-1-amine?
(2E)-3,7-dimethyl-N-[3-(1-methylpiperidin-1-ium-1-yl)propyl]octa-2,6-dien-1-amine has a molecular weight of 293.52 g/mol, XLogP of 4.29, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-3,7-dimethyl-N-[3-(1-methylpiperidin-1-ium-1-yl)propyl]octa-2,6-dien-1-amine is sourced from PubChem (CID 66920096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).