About 3-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-amine
3-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-amine (PubChem CID 66920154) has the molecular formula C10H15NS
and a molecular weight of 181.30 g/mol. Its IUPAC name is 3-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-amine.
Molecular Properties
| Compound Name | 3-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-amine |
| PubChem CID | 66920154 |
| Molecular Formula | C10H15NS |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 3-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-amine |
| SMILES | CCc1c(N)sc2c1CCCC2 |
| InChI | InChI=1S/C10H15NS/c1-2-7-8-5-3-4-6-9(8)12-10(7)11/h2-6,11H2,1H3 |
| InChIKey | BTLPAXYSZRLVDG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-amine?
The IUPAC name of 3-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-amine (CID 66920154) is 3-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-amine.
What is the SMILES notation for 3-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-amine?
The canonical SMILES for 3-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-amine is CCc1c(N)sc2c1CCCC2.
What is the InChIKey of 3-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-amine?
The InChIKey is BTLPAXYSZRLVDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NS/c1-2-7-8-5-3-4-6-9(8)12-10(7)11/h2-6,11H2,1H3.
What are the key properties of 3-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-amine?
3-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-amine has a molecular weight of 181.30 g/mol, XLogP of 2.77, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-amine is sourced from PubChem (CID 66920154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).