About methyl (2Z)-4,4,4-trifluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate
methyl (2Z)-4,4,4-trifluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate (PubChem CID 66920513) has the molecular formula C11H14F3NO3
and a molecular weight of 265.23 g/mol. Its IUPAC name is methyl (2Z)-4,4,4-trifluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate.
Molecular Properties
| Compound Name | methyl (2Z)-4,4,4-trifluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate |
| PubChem CID | 66920513 |
| Molecular Formula | C11H14F3NO3 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | methyl (2Z)-4,4,4-trifluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate |
| SMILES | COC(=O)/C(=C\N1CCCCC1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C11H14F3NO3/c1-18-10(17)8(9(16)11(12,13)14)7-15-5-3-2-4-6-15/h7H,2-6H2,1H3/b8-7- |
| InChIKey | WXMRKQSMYLTKMK-FPLPWBNLSA-N |
| XLogP | 1.66 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze methyl (2Z)-4,4,4-trifluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2Z)-4,4,4-trifluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate?
The IUPAC name of methyl (2Z)-4,4,4-trifluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate (CID 66920513) is methyl (2Z)-4,4,4-trifluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate.
What is the SMILES notation for methyl (2Z)-4,4,4-trifluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate?
The canonical SMILES for methyl (2Z)-4,4,4-trifluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate is COC(=O)/C(=C\N1CCCCC1)C(=O)C(F)(F)F.
What is the InChIKey of methyl (2Z)-4,4,4-trifluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate?
The InChIKey is WXMRKQSMYLTKMK-FPLPWBNLSA-N. The full InChI is InChI=1S/C11H14F3NO3/c1-18-10(17)8(9(16)11(12,13)14)7-15-5-3-2-4-6-15/h7H,2-6H2,1H3/b8-7-.
What are the key properties of methyl (2Z)-4,4,4-trifluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate?
methyl (2Z)-4,4,4-trifluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate has a molecular weight of 265.23 g/mol, XLogP of 1.66, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2Z)-4,4,4-trifluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate is sourced from PubChem (CID 66920513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).