7-methoxy-3-methyl-2H-indazole-5-carboxylic acid

C10H10N2O3 — CID 66920545

IUPAC7-methoxy-3-methyl-2H-indazole-5-carboxylic acid
SMILESCOc1cc(C(=O)O)cc2c(C)[nH]nc12
InChIInChI=1S/C10H10N2O3/c1-5-7-3-6(10(13)14)4-8(15-2)9(7)12-11-5/h3-4H,1-2H3,(H,11,12)(H,13,14)
InChIKeyXBYYNTYGENEUGY-UHFFFAOYSA-N
MW206.20 g/mol
LogP1.58
Rot. Bonds2

About 7-methoxy-3-methyl-2H-indazole-5-carboxylic acid

7-methoxy-3-methyl-2H-indazole-5-carboxylic acid (PubChem CID 66920545) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is 7-methoxy-3-methyl-2H-indazole-5-carboxylic acid.

Molecular Properties

Compound Name7-methoxy-3-methyl-2H-indazole-5-carboxylic acid
PubChem CID66920545
Molecular FormulaC10H10N2O3
Molecular Weight206.20 g/mol
Exact Mass206.07
IUPAC Name7-methoxy-3-methyl-2H-indazole-5-carboxylic acid
SMILESCOc1cc(C(=O)O)cc2c(C)[nH]nc12
InChIInChI=1S/C10H10N2O3/c1-5-7-3-6(10(13)14)4-8(15-2)9(7)12-11-5/h3-4H,1-2H3,(H,11,12)(H,13,14)
InChIKeyXBYYNTYGENEUGY-UHFFFAOYSA-N
XLogP1.58
TPSA75.21 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.20
LogP ≤ 51.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 7-methoxy-3-methyl-2H-indazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(7-methoxy-3-methyl-2H-indazol-5-yl)methanamine
CID 117109639
2-tert-butyl-1'-(7-methoxy-3-methyl-2H-indazole-5-carbonyl)spiro[5,7-dihydro-1,3-benzothiazole-6,4'-piperidine]-4-one
CID 170744723
4,9-dimethoxyphenazine-2,7-dicarboxylic acid
CID 146380937
7-ethoxy-3-ethyl-2H-indazole-5-carboxylic acid
CID 66920448
4-carboxy-2,6-dimethoxyphenolate
CID 54694262
3-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methoxybenzoic acid
CID 82039745
4-hydroxy-3,5-dimethoxybenzoic acid;hydrochloride
CID 162316978
5,6-dimethoxypyridine-3-carboxylic acid
CID 12563086
4-(4-fluorophenoxy)-3,5-dimethoxybenzoic acid
CID 170440928
7-methoxy-2,3-dimethyl-1-benzofuran-5-carboxylic acid
CID 23468813
7-methoxy-1,2,3-trimethylindole-5-carboxylic acid
CID 84696644
3-methyl-2H-pyrazolo[4,3-b]pyridine-6-carboxylic acid
CID 84717839

Frequently Asked Questions

What is the IUPAC name of 7-methoxy-3-methyl-2H-indazole-5-carboxylic acid?
The IUPAC name of 7-methoxy-3-methyl-2H-indazole-5-carboxylic acid (CID 66920545) is 7-methoxy-3-methyl-2H-indazole-5-carboxylic acid.
What is the SMILES notation for 7-methoxy-3-methyl-2H-indazole-5-carboxylic acid?
The canonical SMILES for 7-methoxy-3-methyl-2H-indazole-5-carboxylic acid is COc1cc(C(=O)O)cc2c(C)[nH]nc12.
What is the InChIKey of 7-methoxy-3-methyl-2H-indazole-5-carboxylic acid?
The InChIKey is XBYYNTYGENEUGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O3/c1-5-7-3-6(10(13)14)4-8(15-2)9(7)12-11-5/h3-4H,1-2H3,(H,11,12)(H,13,14).
What are the key properties of 7-methoxy-3-methyl-2H-indazole-5-carboxylic acid?
7-methoxy-3-methyl-2H-indazole-5-carboxylic acid has a molecular weight of 206.20 g/mol, XLogP of 1.58, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-3-methyl-2H-indazole-5-carboxylic acid is sourced from PubChem (CID 66920545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).