About 4,6-bis(hydroxymethyl)benzene-1,3-diol
4,6-bis(hydroxymethyl)benzene-1,3-diol (PubChem CID 66920860) has the molecular formula C8H10O4
and a molecular weight of 170.16 g/mol. Its IUPAC name is 4,6-bis(hydroxymethyl)benzene-1,3-diol.
Molecular Properties
| Compound Name | 4,6-bis(hydroxymethyl)benzene-1,3-diol |
| PubChem CID | 66920860 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 4,6-bis(hydroxymethyl)benzene-1,3-diol |
| SMILES | OCc1cc(CO)c(O)cc1O |
| InChI | InChI=1S/C8H10O4/c9-3-5-1-6(4-10)8(12)2-7(5)11/h1-2,9-12H,3-4H2 |
| InChIKey | ASXBFZBEXQRQLK-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,6-bis(hydroxymethyl)benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-bis(hydroxymethyl)benzene-1,3-diol?
The IUPAC name of 4,6-bis(hydroxymethyl)benzene-1,3-diol (CID 66920860) is 4,6-bis(hydroxymethyl)benzene-1,3-diol.
What is the SMILES notation for 4,6-bis(hydroxymethyl)benzene-1,3-diol?
The canonical SMILES for 4,6-bis(hydroxymethyl)benzene-1,3-diol is OCc1cc(CO)c(O)cc1O.
What is the InChIKey of 4,6-bis(hydroxymethyl)benzene-1,3-diol?
The InChIKey is ASXBFZBEXQRQLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O4/c9-3-5-1-6(4-10)8(12)2-7(5)11/h1-2,9-12H,3-4H2.
What are the key properties of 4,6-bis(hydroxymethyl)benzene-1,3-diol?
4,6-bis(hydroxymethyl)benzene-1,3-diol has a molecular weight of 170.16 g/mol, XLogP of 0.08, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-bis(hydroxymethyl)benzene-1,3-diol is sourced from PubChem (CID 66920860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).