About CID 66920881
CID 66920881 (PubChem CID 66920881) has the molecular formula C12H12N3P
and a molecular weight of 229.22 g/mol.
Molecular Properties
| Compound Name | CID 66920881 |
| PubChem CID | 66920881 |
| Molecular Formula | C12H12N3P |
| Molecular Weight | 229.22 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | — |
| SMILES | [N-]=[N+]=N.c1ccc(Pc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11P.HN3/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-2/h1-10,13H;1H |
| InChIKey | UDLUCRWFOMUJIZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 60.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.22 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze CID 66920881 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66920881?
The IUPAC name of CID 66920881 (CID 66920881) is not available.
What is the SMILES notation for CID 66920881?
The canonical SMILES for CID 66920881 is [N-]=[N+]=N.c1ccc(Pc2ccccc2)cc1.
What is the InChIKey of CID 66920881?
The InChIKey is UDLUCRWFOMUJIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11P.HN3/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-2/h1-10,13H;1H.
What are the key properties of CID 66920881?
CID 66920881 has a molecular weight of 229.22 g/mol, XLogP of 3.19, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66920881 is sourced from PubChem (CID 66920881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).