About [(5S,6S)-6-(nitromethyl)-5,6-dihydrobenzo[b][1]benzoxepin-5-yl]methanol
[(5S,6S)-6-(nitromethyl)-5,6-dihydrobenzo[b][1]benzoxepin-5-yl]methanol (PubChem CID 66921005) has the molecular formula C16H15NO4
and a molecular weight of 285.30 g/mol. Its IUPAC name is [(5S,6S)-6-(nitromethyl)-5,6-dihydrobenzo[b][1]benzoxepin-5-yl]methanol.
Molecular Properties
| Compound Name | [(5S,6S)-6-(nitromethyl)-5,6-dihydrobenzo[b][1]benzoxepin-5-yl]methanol |
| PubChem CID | 66921005 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | [(5S,6S)-6-(nitromethyl)-5,6-dihydrobenzo[b][1]benzoxepin-5-yl]methanol |
| SMILES | O=[N+]([O-])C[C@@H]1c2ccccc2Oc2ccccc2[C@H]1CO |
| InChI | InChI=1S/C16H15NO4/c18-10-14-12-6-2-4-8-16(12)21-15-7-3-1-5-11(15)13(14)9-17(19)20/h1-8,13-14,18H,9-10H2/t13-,14-/m1/s1 |
| InChIKey | WKEPYJOESOCISZ-ZIAGYGMSSA-N |
| XLogP | 2.93 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(5S,6S)-6-(nitromethyl)-5,6-dihydrobenzo[b][1]benzoxepin-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5S,6S)-6-(nitromethyl)-5,6-dihydrobenzo[b][1]benzoxepin-5-yl]methanol?
The IUPAC name of [(5S,6S)-6-(nitromethyl)-5,6-dihydrobenzo[b][1]benzoxepin-5-yl]methanol (CID 66921005) is [(5S,6S)-6-(nitromethyl)-5,6-dihydrobenzo[b][1]benzoxepin-5-yl]methanol.
What is the SMILES notation for [(5S,6S)-6-(nitromethyl)-5,6-dihydrobenzo[b][1]benzoxepin-5-yl]methanol?
The canonical SMILES for [(5S,6S)-6-(nitromethyl)-5,6-dihydrobenzo[b][1]benzoxepin-5-yl]methanol is O=[N+]([O-])C[C@@H]1c2ccccc2Oc2ccccc2[C@H]1CO.
What is the InChIKey of [(5S,6S)-6-(nitromethyl)-5,6-dihydrobenzo[b][1]benzoxepin-5-yl]methanol?
The InChIKey is WKEPYJOESOCISZ-ZIAGYGMSSA-N. The full InChI is InChI=1S/C16H15NO4/c18-10-14-12-6-2-4-8-16(12)21-15-7-3-1-5-11(15)13(14)9-17(19)20/h1-8,13-14,18H,9-10H2/t13-,14-/m1/s1.
What are the key properties of [(5S,6S)-6-(nitromethyl)-5,6-dihydrobenzo[b][1]benzoxepin-5-yl]methanol?
[(5S,6S)-6-(nitromethyl)-5,6-dihydrobenzo[b][1]benzoxepin-5-yl]methanol has a molecular weight of 285.30 g/mol, XLogP of 2.93, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(5S,6S)-6-(nitromethyl)-5,6-dihydrobenzo[b][1]benzoxepin-5-yl]methanol is sourced from PubChem (CID 66921005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).