C14H23NO5 — CID 66921219
tert-butyl 3,3-dimethoxy-6-methylidene-2,3a,5,6a-tetrahydrofuro[3,2-b]pyrrole-4-carboxylate (PubChem CID 66921219) has the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. Its IUPAC name is tert-butyl 3,3-dimethoxy-6-methylidene-2,3a,5,6a-tetrahydrofuro[3,2-b]pyrrole-4-carboxylate.
| Compound Name | tert-butyl 3,3-dimethoxy-6-methylidene-2,3a,5,6a-tetrahydrofuro[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 66921219 |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | tert-butyl 3,3-dimethoxy-6-methylidene-2,3a,5,6a-tetrahydrofuro[3,2-b]pyrrole-4-carboxylate |
| SMILES | C=C1CN(C(=O)OC(C)(C)C)C2C1OCC2(OC)OC |
| InChI | InChI=1S/C14H23NO5/c1-9-7-15(12(16)20-13(2,3)4)11-10(9)19-8-14(11,17-5)18-6/h10-11H,1,7-8H2,2-6H3 |
| InChIKey | BPKHHYSXVSBOBT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|