C17H19ClN2O4 — CID 66921446
ethyl (Z)-4-[4-chloro-2-(cyclopropylmethylcarbamoyl)anilino]-4-oxobut-2-enoate (PubChem CID 66921446) has the molecular formula C17H19ClN2O4 and a molecular weight of 350.80 g/mol. Its IUPAC name is ethyl (Z)-4-[4-chloro-2-(cyclopropylmethylcarbamoyl)anilino]-4-oxobut-2-enoate.
| Compound Name | ethyl (Z)-4-[4-chloro-2-(cyclopropylmethylcarbamoyl)anilino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 66921446 |
| Molecular Formula | C17H19ClN2O4 |
| Molecular Weight | 350.80 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | ethyl (Z)-4-[4-chloro-2-(cyclopropylmethylcarbamoyl)anilino]-4-oxobut-2-enoate |
| SMILES | CCOC(=O)/C=C\C(=O)Nc1ccc(Cl)cc1C(=O)NCC1CC1 |
| InChI | InChI=1S/C17H19ClN2O4/c1-2-24-16(22)8-7-15(21)20-14-6-5-12(18)9-13(14)17(23)19-10-11-3-4-11/h5-9,11H,2-4,10H2,1H3,(H,19,23)(H,20,21)/b8-7- |
| InChIKey | INNHZJMFGFSMFS-FPLPWBNLSA-N |
| XLogP | 2.54 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.80 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|