About N-[(1R,6R)-4-bromo-6-pentan-3-yloxycyclohexa-2,4-dien-1-yl]acetamide
N-[(1R,6R)-4-bromo-6-pentan-3-yloxycyclohexa-2,4-dien-1-yl]acetamide (PubChem CID 66921867) has the molecular formula C13H20BrNO2
and a molecular weight of 302.21 g/mol. Its IUPAC name is N-[(1R,6R)-4-bromo-6-pentan-3-yloxycyclohexa-2,4-dien-1-yl]acetamide.
Molecular Properties
| Compound Name | N-[(1R,6R)-4-bromo-6-pentan-3-yloxycyclohexa-2,4-dien-1-yl]acetamide |
| PubChem CID | 66921867 |
| Molecular Formula | C13H20BrNO2 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | N-[(1R,6R)-4-bromo-6-pentan-3-yloxycyclohexa-2,4-dien-1-yl]acetamide |
| SMILES | CCC(CC)O[C@@H]1C=C(Br)C=C[C@H]1NC(C)=O |
| InChI | InChI=1S/C13H20BrNO2/c1-4-11(5-2)17-13-8-10(14)6-7-12(13)15-9(3)16/h6-8,11-13H,4-5H2,1-3H3,(H,15,16)/t12-,13-/m1/s1 |
| InChIKey | HCKVPZFMLGNVGJ-CHWSQXEVSA-N |
| XLogP | 2.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(1R,6R)-4-bromo-6-pentan-3-yloxycyclohexa-2,4-dien-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,6R)-4-bromo-6-pentan-3-yloxycyclohexa-2,4-dien-1-yl]acetamide?
The IUPAC name of N-[(1R,6R)-4-bromo-6-pentan-3-yloxycyclohexa-2,4-dien-1-yl]acetamide (CID 66921867) is N-[(1R,6R)-4-bromo-6-pentan-3-yloxycyclohexa-2,4-dien-1-yl]acetamide.
What is the SMILES notation for N-[(1R,6R)-4-bromo-6-pentan-3-yloxycyclohexa-2,4-dien-1-yl]acetamide?
The canonical SMILES for N-[(1R,6R)-4-bromo-6-pentan-3-yloxycyclohexa-2,4-dien-1-yl]acetamide is CCC(CC)O[C@@H]1C=C(Br)C=C[C@H]1NC(C)=O.
What is the InChIKey of N-[(1R,6R)-4-bromo-6-pentan-3-yloxycyclohexa-2,4-dien-1-yl]acetamide?
The InChIKey is HCKVPZFMLGNVGJ-CHWSQXEVSA-N. The full InChI is InChI=1S/C13H20BrNO2/c1-4-11(5-2)17-13-8-10(14)6-7-12(13)15-9(3)16/h6-8,11-13H,4-5H2,1-3H3,(H,15,16)/t12-,13-/m1/s1.
What are the key properties of N-[(1R,6R)-4-bromo-6-pentan-3-yloxycyclohexa-2,4-dien-1-yl]acetamide?
N-[(1R,6R)-4-bromo-6-pentan-3-yloxycyclohexa-2,4-dien-1-yl]acetamide has a molecular weight of 302.21 g/mol, XLogP of 2.91, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,6R)-4-bromo-6-pentan-3-yloxycyclohexa-2,4-dien-1-yl]acetamide is sourced from PubChem (CID 66921867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).