C15H23Br2NO4 — CID 66921872
[(1S,2R,5R,6S)-6-acetamido-2,3-dibromo-5-pentan-3-yloxycyclohex-3-en-1-yl] acetate (PubChem CID 66921872) has the molecular formula C15H23Br2NO4 and a molecular weight of 441.16 g/mol. Its IUPAC name is [(1S,2R,5R,6S)-6-acetamido-2,3-dibromo-5-pentan-3-yloxycyclohex-3-en-1-yl] acetate.
| Compound Name | [(1S,2R,5R,6S)-6-acetamido-2,3-dibromo-5-pentan-3-yloxycyclohex-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 66921872 |
| Molecular Formula | C15H23Br2NO4 |
| Molecular Weight | 441.16 g/mol |
| Exact Mass | 439.00 |
| IUPAC Name | [(1S,2R,5R,6S)-6-acetamido-2,3-dibromo-5-pentan-3-yloxycyclohex-3-en-1-yl] acetate |
| SMILES | CCC(CC)O[C@@H]1C=C(Br)[C@H](Br)[C@@H](OC(C)=O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C15H23Br2NO4/c1-5-10(6-2)22-12-7-11(16)13(17)15(21-9(4)20)14(12)18-8(3)19/h7,10,12-15H,5-6H2,1-4H3,(H,18,19)/t12-,13+,14+,15-/m1/s1 |
| InChIKey | NKVYIPWRIRXGEP-CBBWQLFWSA-N |
| XLogP | 3.05 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.16 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|