About 5-(2-oxo-[1,3]oxazolo[4,5-b]pyridin-3-yl)pentanamide
5-(2-oxo-[1,3]oxazolo[4,5-b]pyridin-3-yl)pentanamide (PubChem CID 66921889) has the molecular formula C11H13N3O3
and a molecular weight of 235.24 g/mol. Its IUPAC name is 5-(2-oxo-[1,3]oxazolo[4,5-b]pyridin-3-yl)pentanamide.
Molecular Properties
| Compound Name | 5-(2-oxo-[1,3]oxazolo[4,5-b]pyridin-3-yl)pentanamide |
| PubChem CID | 66921889 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 5-(2-oxo-[1,3]oxazolo[4,5-b]pyridin-3-yl)pentanamide |
| SMILES | NC(=O)CCCCn1c(=O)oc2cccnc21 |
| InChI | InChI=1S/C11H13N3O3/c12-9(15)5-1-2-7-14-10-8(17-11(14)16)4-3-6-13-10/h3-4,6H,1-2,5,7H2,(H2,12,15) |
| InChIKey | ZLVWDTRGMWJFED-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-oxo-[1,3]oxazolo[4,5-b]pyridin-3-yl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-oxo-[1,3]oxazolo[4,5-b]pyridin-3-yl)pentanamide?
The IUPAC name of 5-(2-oxo-[1,3]oxazolo[4,5-b]pyridin-3-yl)pentanamide (CID 66921889) is 5-(2-oxo-[1,3]oxazolo[4,5-b]pyridin-3-yl)pentanamide.
What is the SMILES notation for 5-(2-oxo-[1,3]oxazolo[4,5-b]pyridin-3-yl)pentanamide?
The canonical SMILES for 5-(2-oxo-[1,3]oxazolo[4,5-b]pyridin-3-yl)pentanamide is NC(=O)CCCCn1c(=O)oc2cccnc21.
What is the InChIKey of 5-(2-oxo-[1,3]oxazolo[4,5-b]pyridin-3-yl)pentanamide?
The InChIKey is ZLVWDTRGMWJFED-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O3/c12-9(15)5-1-2-7-14-10-8(17-11(14)16)4-3-6-13-10/h3-4,6H,1-2,5,7H2,(H2,12,15).
What are the key properties of 5-(2-oxo-[1,3]oxazolo[4,5-b]pyridin-3-yl)pentanamide?
5-(2-oxo-[1,3]oxazolo[4,5-b]pyridin-3-yl)pentanamide has a molecular weight of 235.24 g/mol, XLogP of 0.65, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-oxo-[1,3]oxazolo[4,5-b]pyridin-3-yl)pentanamide is sourced from PubChem (CID 66921889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).