C16H31N2O8P — CID 66921999
(3R,4R,5S)-4-[acetyl(ethyl)amino]-5-amino-3-pentan-3-yloxycyclohexene-1-carboxylic acid;phosphoric acid (PubChem CID 66921999) has the molecular formula C16H31N2O8P and a molecular weight of 410.40 g/mol. Its IUPAC name is (3R,4R,5S)-4-[acetyl(ethyl)amino]-5-amino-3-pentan-3-yloxycyclohexene-1-carboxylic acid;phosphoric acid.
| Compound Name | (3R,4R,5S)-4-[acetyl(ethyl)amino]-5-amino-3-pentan-3-yloxycyclohexene-1-carboxylic acid;phosphoric acid |
|---|---|
| PubChem CID | 66921999 |
| Molecular Formula | C16H31N2O8P |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | (3R,4R,5S)-4-[acetyl(ethyl)amino]-5-amino-3-pentan-3-yloxycyclohexene-1-carboxylic acid;phosphoric acid |
| SMILES | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](N)[C@H]1N(CC)C(C)=O.O=P(O)(O)O |
| InChI | InChI=1S/C16H28N2O4.H3O4P/c1-5-12(6-2)22-14-9-11(16(20)21)8-13(17)15(14)18(7-3)10(4)19;1-5(2,3)4/h9,12-15H,5-8,17H2,1-4H3,(H,20,21);(H3,1,2,3,4)/t13-,14+,15+;/m0./s1 |
| InChIKey | OFLCIEDYRGJHNO-ONAKXNSWSA-N |
| XLogP | 0.61 |
| TPSA | 170.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|