About 2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyethanol;hydrochloride
2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyethanol;hydrochloride (PubChem CID 66922788) has the molecular formula C9H12ClN3O2
and a molecular weight of 229.67 g/mol. Its IUPAC name is 2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyethanol;hydrochloride.
Molecular Properties
| Compound Name | 2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyethanol;hydrochloride |
| PubChem CID | 66922788 |
| Molecular Formula | C9H12ClN3O2 |
| Molecular Weight | 229.67 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyethanol;hydrochloride |
| SMILES | Cl.Nc1c(OCCO)nn2ccccc12 |
| InChI | InChI=1S/C9H11N3O2.ClH/c10-8-7-3-1-2-4-12(7)11-9(8)14-6-5-13;/h1-4,13H,5-6,10H2;1H |
| InChIKey | HFFCVKYVJNYQLA-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.67 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyethanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyethanol;hydrochloride?
The IUPAC name of 2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyethanol;hydrochloride (CID 66922788) is 2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyethanol;hydrochloride.
What is the SMILES notation for 2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyethanol;hydrochloride?
The canonical SMILES for 2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyethanol;hydrochloride is Cl.Nc1c(OCCO)nn2ccccc12.
What is the InChIKey of 2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyethanol;hydrochloride?
The InChIKey is HFFCVKYVJNYQLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O2.ClH/c10-8-7-3-1-2-4-12(7)11-9(8)14-6-5-13;/h1-4,13H,5-6,10H2;1H.
What are the key properties of 2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyethanol;hydrochloride?
2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyethanol;hydrochloride has a molecular weight of 229.67 g/mol, XLogP of 0.71, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-aminopyrazolo[1,5-a]pyridin-2-yl)oxyethanol;hydrochloride is sourced from PubChem (CID 66922788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).