C9H24N4O3S3 — CID 66922950
azane;ethanol;1,3,5-triazinane-2,4,6-trithione (PubChem CID 66922950) has the molecular formula C9H24N4O3S3 and a molecular weight of 332.52 g/mol. Its IUPAC name is azane;ethanol;1,3,5-triazinane-2,4,6-trithione.
| Compound Name | azane;ethanol;1,3,5-triazinane-2,4,6-trithione |
|---|---|
| PubChem CID | 66922950 |
| Molecular Formula | C9H24N4O3S3 |
| Molecular Weight | 332.52 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | azane;ethanol;1,3,5-triazinane-2,4,6-trithione |
| SMILES | CCO.CCO.CCO.N.S=c1[nH]c(=S)[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C3H3N3S3.3C2H6O.H3N/c7-1-4-2(8)6-3(9)5-1;3*1-2-3;/h(H3,4,5,6,7,8,9);3*3H,2H2,1H3;1H3 |
| InChIKey | SFWSJYOKVHHSIU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.52 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|