C9H18N4O3S3 — CID 66922951
2-[bis(2-hydroxyethyl)amino]ethanol;1,3,5-triazinane-2,4,6-trithione (PubChem CID 66922951) has the molecular formula C9H18N4O3S3 and a molecular weight of 326.47 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;1,3,5-triazinane-2,4,6-trithione.
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;1,3,5-triazinane-2,4,6-trithione |
|---|---|
| PubChem CID | 66922951 |
| Molecular Formula | C9H18N4O3S3 |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;1,3,5-triazinane-2,4,6-trithione |
| SMILES | OCCN(CCO)CCO.S=c1[nH]c(=S)[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C6H15NO3.C3H3N3S3/c8-4-1-7(2-5-9)3-6-10;7-1-4-2(8)6-3(9)5-1/h8-10H,1-6H2;(H3,4,5,6,7,8,9) |
| InChIKey | FDQMTAGXHQQJJR-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 111.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|