C35H41ClN2O7 — CID 6692327
[(2S)-1-[3-[(2R,4R,5S,6S)-4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]anilino]-1-oxopropan-2-yl] acetate (PubChem CID 6692327) has the molecular formula C35H41ClN2O7 and a molecular weight of 637.17 g/mol. Its IUPAC name is [(2S)-1-[3-[(2R,4R,5S,6S)-4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]anilino]-1-oxopropan-2-yl] acetate.
| Compound Name | [(2S)-1-[3-[(2R,4R,5S,6S)-4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]anilino]-1-oxopropan-2-yl] acetate |
|---|---|
| PubChem CID | 6692327 |
| Molecular Formula | C35H41ClN2O7 |
| Molecular Weight | 637.17 g/mol |
| Exact Mass | 636.26 |
| IUPAC Name | [(2S)-1-[3-[(2R,4R,5S,6S)-4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]anilino]-1-oxopropan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](C)C(=O)Nc1cccc([C@@H]2OC(c3ccc(CO)cc3)[C@H](C)[C@H](CN3CCC(O)(c4ccc(Cl)cc4)CC3)O2)c1 |
| InChI | InChI=1S/C35H41ClN2O7/c1-22-31(20-38-17-15-35(42,16-18-38)28-11-13-29(36)14-12-28)44-34(45-32(22)26-9-7-25(21-39)8-10-26)27-5-4-6-30(19-27)37-33(41)23(2)43-24(3)40/h4-14,19,22-23,31-32,34,39,42H,15-18,20-21H2,1-3H3,(H,37,41)/t22-,23+,31+,32?,34+/m1/s1 |
| InChIKey | XRWWTZGEQFJOST-BJGFUDORSA-N |
| XLogP | 5.50 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.17 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |